A7851312
Tetramethyl tBuXPhos , ≥98% , 857356-94-6
Synonym(s):
2-Di-tert-butylphosphino-3,4,5,6-tetramethyl-2′,4′,6′-triisopropyl-1,1′-biphenyl;Tetramethyl di-tBuXPhos;Tetramethyl tBuXPhos
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB160.00 | In Stock |
|
| 250MG | RMB373.60 | In Stock |
|
| 1G | RMB1128.80 | In Stock |
|
| 5g | RMB5519.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 168-172 °C |
| Boiling point: | 534.1±50.0 °C(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | crystal |
| color | white microcrystal |
| InChI | InChI=1S/C33H53P/c1-19(2)26-17-27(20(3)4)30(28(18-26)21(5)6)29-24(9)22(7)23(8)25(10)31(29)34(32(11,12)13)33(14,15)16/h17-21H,1-16H3 |
| InChIKey | RCRYEYMHBHPZQD-UHFFFAOYSA-N |
| SMILES | P(C(C)(C)C)(C(C)(C)C)C1=C(C)C(C)=C(C)C(C)=C1C1=C(C(C)C)C=C(C(C)C)C=C1C(C)C |
| CAS DataBase Reference | 857356-94-6 |
Description and Uses
Ligand used in a palladium-catalyzed amidation of aryl chlorides.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280-P305+P351+P338-P304+P340-P405-P501A |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37-60 |
| WGK Germany | 3 |
| TSCA | No |
| Storage Class | 11 - Combustible Solids |





