A3919356
N2-IsobutyrylguanosineMonohydrate , 95% , 64350-24-9
CAS NO.：64350-24-9
Empirical Formula: C14H19N5O6
Molecular Weight: 353.33
MDL number: MFCD00274102
EINECS: 2017-001-1
| Pack Size | Price | Stock | Quantity |
| 5g | RMB63.20 | In Stock |
|
| 10g | RMB111.20 | In Stock |
|
| 25g | RMB223.20 | In Stock |
|
| 100g | RMB959.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 148 °C |
| Density | 1.82±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 9.16±0.20(Predicted) |
| color | White to Off-White |
| InChIKey | OXTYJSXVUGJSGM-HTVVRFAVSA-N |
| SMILES | OC[C@H]1O[C@@H](N2C3=C(C(NC(=N3)NC(=O)C(C)C)=O)N=C2)[C@H](O)[C@@H]1O |
| CAS DataBase Reference | 64350-24-9 |
Description and Uses
N2-Isobutyrylguanosine is a synthetic nucleoside analog. N-Isobutyrylguanosine can be used in the syntehsis of 2'-O-(o-nitrobenzyl)-3'-thioguanosine phosphoramidite which is then used to form oligonucleotides, substrates for probing the mechanism of RNA catalysis.
N-Isobutyrylguanosine is used in the syntehsis of 2''-O-(o-nitrobenzyl)-3''-thioguanosine phosphoramidite which is then used to form oligonucleotides, substrates for probing the mechanism of RNA catalysis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P302+P352-P362+P364 |
| HS Code | 29389090 |
