A3931612
Ethyl 3-chloropropionate , 98% , 623-71-2
CAS NO.：623-71-2
Empirical Formula: C5H9ClO2
Molecular Weight: 136.58
MDL number: MFCD00000989
EINECS: 210-809-2
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 162-163 °C(lit.) |
| Density | 1.003 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 130 °F |
| storage temp. | Store below +30°C. |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 1.00 |
| Water Solubility | Immiscible |
| BRN | 385698 |
| Dielectric constant | 10.1（20℃） |
| InChI | InChI=1S/C5H9ClO2/c1-2-8-5(7)3-4-6/h2-4H2,1H3 |
| InChIKey | ZCLGVXACCAZJOX-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)CCCl |
| CAS DataBase Reference | 623-71-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Ethyl 3-chloropropionate(623-71-2) |
| EPA Substance Registry System | Propanoic acid, 3-chloro-, ethyl ester (623-71-2) |
Description and Uses
Ethyl β-chloropropionate, is a building block used in various chemical synthesis.
Safety
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H226-H227 |
| Precautionary statements | P210e-P280a-P405-P501a-P210-P233-P240-P241+P242+P243-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P403+P235-P501-P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-10 |
| Safety Statements | 26-36-37/39-16 |
| RIDADR | 3272 |
| WGK Germany | 3 |
| TSCA | Yes |
| HazardClass | 3.2 |
| PackingGroup | III |
| HS Code | 29159080 |
