A3937112
3-Ethylaniline , 98% , 587-02-0
CAS NO.：587-02-0
Empirical Formula: C8H11N
Molecular Weight: 121.18
MDL number: MFCD00007818
EINECS: 209-594-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB44.80 | In Stock |
|
| 5G | RMB95.20 | In Stock |
|
| 10G | RMB167.20 | In Stock |
|
| 25G | RMB325.60 | In Stock |
|
| 50G | RMB599.20 | In Stock |
|
| 100G | RMB1151.20 | In Stock |
|
| 500g | RMB5119.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -8 °C (lit.) |
| Boiling point: | 212 °C (lit.) |
| Density | 0.975 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 185 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | pK1:4.70(+1) (25°C) |
| form | Powder |
| color | White to light beige or light gray |
| BRN | 636282 |
| Dielectric constant | 6.0（20℃） |
| InChI | InChI=1S/C8H11N/c1-2-7-4-3-5-8(9)6-7/h3-6H,2,9H2,1H3 |
| InChIKey | AMKPQMFZCBTTAT-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=CC(CC)=C1 |
| CAS DataBase Reference | 587-02-0(CAS DataBase Reference) |
Description and Uses
3-Ethylaniline acts as a reagent in the design, synthesis and biological evaluation of thienopyrimidine hydroxamic acid based derivatives as structurally novel histone deacetylase (HDAC) inhibitors. Synthesis and biological evaluation of novel 2-aminonicotinamide derivatives as antifungal agents.
Safety
| Symbol(GHS) |   GHS06,GHS07 |
| Signal word | Danger |
| Hazard statements | H227-H302-H311+H331-H315-H319 |
| Precautionary statements | P210-P261-P264-P270-P271-P280-P301+P312+P330-P302+P352+P312+P361+P364-P304+P340+P311-P305+P351+P338+P337+P313-P370+P378-P403+P233-P405-P501 |
| Hazard Codes | T,Xi |
| Risk Statements | 23/24/25-33 |
| Safety Statements | 36/37/39-45 |
| RIDADR | UN 2810 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | BX9770000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29214990 |
