A3942812
4-Ethylphenylboronic acid , 97% , 63139-21-9
Synonym(s):
(ρ-Ethylphenyl)boronic acid;4-Ethylbenzeneboronic acid
CAS NO.：63139-21-9
Empirical Formula: C8H11BO2
Molecular Weight: 149.98
MDL number: MFCD00859377
EINECS: 613-145-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB31.20 | In Stock |
|
| 25G | RMB99.20 | In Stock |
|
| 100G | RMB347.20 | In Stock |
|
| 500g | RMB1599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 150-155 °C (lit.) |
| Boiling point: | 285.1±33.0 °C(Predicted) |
| Density | 1.125 g/cm3 (20℃) |
| vapor pressure | 0-0Pa at 20-50℃ |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | 1.2g/l |
| form | Crystalline Powder |
| pka | 8.87±0.10(Predicted) |
| color | White |
| BRN | 3030638 |
| InChI | InChI=1S/C8H11BO2/c1-2-7-3-5-8(6-4-7)9(10)11/h3-6,10-11H,2H2,1H3 |
| InChIKey | RZCPLOMUUCFPQA-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(CC)C=C1)(O)O |
| LogP | 2.8 at 25℃ and pH3.5 |
| Surface tension | 50mN/m at 1g/L and 20℃ |
| CAS DataBase Reference | 63139-21-9(CAS DataBase Reference) |
Description and Uses
Reactant for:
- Suzuki-Miyaura cross-coupling reactions
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H319 |
| Precautionary statements | P264-P270-P280-P301+P312-P305+P351+P338-P337+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 37/39-26-36/37 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
