A3957612
Esculin hydrate , 98% , 531-75-9
Synonym(s):
Esculin;Aesculin;Bicolorin;Crataegin;Enallachrome
CAS NO.:531-75-9
Empirical Formula: C15H16O9
Molecular Weight: 340.28
MDL number: MFCD00006879
EINECS: 208-517-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB45.60 | In Stock |
|
| 5G | RMB93.60 | In Stock |
|
| 25G | RMB420.00 | In Stock |
|
| 100g | RMB1536.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 203 °C |
| alpha | -88 º (c=2,dioxane/water1:1) |
| Boiling point: | 396.1°C (rough estimate) |
| Density | 0.791 g/mL at 20 °C |
| vapor pressure | 0Pa at 25℃ |
| refractive index | -79 ° (C=2.4, 50% Dioxane) |
| Flash point: | 15 °C |
| storage temp. | 2-8°C |
| solubility | methanol: 50 mg/mL hot, clear to very faintly turbid, yellow-green fluoresc. |
| form | Liquid |
| pka | 7.00±0.20(Predicted) |
| color | Clear |
| optical activity | [α]20/D 41±2°, c = 5% in pyridine |
| Water Solubility | MODERATELY SOLUBLE |
| Merck | 3698 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Cosmetics Ingredients Functions | TONIC LIGHT STABILIZER |
| InChI | 1S/C15H16O9.H2O/c16-5-10-12(19)13(20)14(21)15(24-10)23-9-3-6-1-2-11(18)22-8(6)4-7(9)17;/h1-4,10,12-17,19-21H,5H2;1H2/t10-,12-,13+,14-,15-;/m1./s1 |
| InChIKey | YRABYCJKUBFWQY-FHXAZYNBSA-N |
| SMILES | O.OC[C@H]1O[C@@H](Oc2cc3C=CC(=O)Oc3cc2O)[C@H](O)[C@@H](O)[C@@H]1O || O.OC[C@H]1O[C@@H](Oc2cc3C=CC(=O)Oc3cc2O)[C@H](O)[C@@H](O)[C@@H]1O |
| LogP | -1.307 (est) |
| CAS DataBase Reference | 531-75-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 7-Hydroxy-2-oxo-2h-chromen-6-yl hexopyranoside(531-75-9) |
| EPA Substance Registry System | Esculin (531-75-9) |
Description and Uses
Esculin hydrate has been used as a component of sporulation-inducing esculin agar. It has also been used for esculin uptake assay.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312+P330-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | F,C,Xi |
| Risk Statements | 11-20/21/22-34-68/20/21/22-36/37/38 |
| Safety Statements | 26-36/37/39-45-24/25-36/37-16 |
| RIDADR | UN 2924 3/PG 2 |
| WGK Germany | 3 |
| RTECS | DJ3085000 |
| F | 3-10-23 |
| TSCA | TSCA listed |
| HS Code | 29389090 |
| Storage Class | 11 - Combustible Solids |




