A3966812
β-Estradiol , Analysis standard product, 99.5% , 50-28-2
Synonym(s):
β-Estradiol;17β-Estradiol;17β-Estradiol - CAS 50-28-2 - Calbiochem;3,17β-Dihydroxy-1,3,5(10)-estratriene;Dihydrofolliculin
CAS NO.：50-28-2
Empirical Formula: C18H24O2
Molecular Weight: 272.39
MDL number: MFCD01074033
EINECS: 200-023-8
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB399.20 | In Stock |
|
| 250MG | RMB796.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 178-179 °C(lit.) |
| Boiling point: | 355.44°C (rough estimate) |
| alpha | D25 +76 to +83° (dioxane) |
| Density | 1.0708 (rough estimate) |
| refractive index | 80.4 ° (C=1, Dioxane) |
| Flash point: | 2℃ |
| storage temp. | room temp |
| solubility | Practically insoluble in water, soluble in acetone, sparingly soluble in ethanol (96 per cent), slightly soluble in methylene chloride. |
| form | powder |
| pka | pKa 10.71±0.02(H2O(0.1% p-dioxane) t=25±0.1 I=0.03(KCl))(Approximate) |
| color | White to off-white |
| biological source | synthetic (organic) |
| Water Solubility | Soluble in dimethyl sulfoxide, ethanol , water, phosphate buffer saline, dimethyl formamide, acetone, dioxane and alkali hydroxides. Slightly soluble in vegetable oils. |
| Merck | 14,3703 |
| BRN | 1914275 |
| BCS Class | 1 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Cosmetics Ingredients Functions | SKIN CONDITIONING |
| InChI | 1S/C18H24O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h3,5,10,14-17,19-20H,2,4,6-9H2,1H3/t14-,15-,16+,17+,18+/m1/s1 |
| InChIKey | VOXZDWNPVJITMN-ZBRFXRBCSA-N |
| SMILES | O[C@H]1CC[C@@]2([H])[C@]3([H])CCC4=CC(O)=CC=C4[C@@]3([H])CC[C@@]21C |
| CAS DataBase Reference | 50-28-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Estra-1,3,5(10)-triene-3,17beta-diol(50-28-2) |
| EPA Substance Registry System | Estradiol (50-28-2) |
Description and Uses
Estradiol, 17-beta- is an odorless white to yellow crystalline substance. Molecular weight = 272.42;Boiling point = (decomposes); Freezing/Meltingpoint = 173 - 179℃. Hazard Identification (based onNFPA-704 M Rating System): Health 2, Flammability 1,Reactivity 0. Insoluble in water.
17β-Estradiol is the major estrogen secreted by the premenopausal ovary.This compound is a contaminant of emerging concern (CECs). Drinking water contaminant candidate list 3 (CCL 3) compound as per United States Environmental Protection Agency (EPA), environmental, and food contaminants.
Safety
| Symbol(GHS) |   GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H351-H360FD-H362-H410 |
| Precautionary statements | P202-P260-P263-P264-P273-P308+P313 |
| PPE | Eyeshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | T,Xn,F |
| Risk Statements | 60-61-45-63-64-40-36-20/21/22-11-48 |
| Safety Statements | 53-22-36/37/39-45-36/37-26-16-36-20 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | KG2975000 |
| F | 8-10 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29372390 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Carc. 2 Lact. Repr. 1A |
| Hazardous Substances Data | 50-28-2(Hazardous Substances Data) |
| Toxicity | LD50 subcutaneous in rat: > 300mg/kg |
