A4004212
Ethyl 5-Amino-1-methylpyrazole-4-carboxylate , ≥98% , 31037-02-2
CAS NO.：31037-02-2
Empirical Formula: C7H11N3O2
Molecular Weight: 169.18
MDL number: MFCD00051652
EINECS: 626-277-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB64.00 | In Stock |
|
| 100G | RMB210.40 | In Stock |
|
| 500g | RMB718.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 96-100 °C |
| Boiling point: | 121 °C(Press: 0.05 Torr) |
| Density | 1.29±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in Methanol |
| form | Crystals or Crystalline Powder |
| pka | 2.03±0.10(Predicted) |
| color | Yellow |
| λmax | 257nm(EtOH)(lit.) |
| Sensitive | Hygroscopic |
| BRN | 131200 |
| InChI | InChI=1S/C7H11N3O2/c1-3-12-7(11)5-4-9-10(2)6(5)8/h4H,3,8H2,1-2H3 |
| InChIKey | MEUSJJFWVKBUFP-UHFFFAOYSA-N |
| SMILES | N1(C)C(N)=C(C(OCC)=O)C=N1 |
| CAS DataBase Reference | 31037-02-2(CAS DataBase Reference) |
Description and Uses
ETHYL 5-AMINO-1-METHYLPYRAZOLE-4-CARBOXYLATE features an amino group and a carboxylic acid moiety, which contribute to its reactivity and potential applications in various chemical reactions. The ethyl ester functional group enhances its solubility in organic solvents, making it useful in synthetic chemistry.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 36/37/39-26-22-36/37 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29331990 |
