A4030712
Ethyl 4,4-difluoroacetoacetate , 98% , 352-24-9
Synonym(s):
Ethyl 4,4-difluoro-3-oxobutanoate;Ethyl 4,4-difluoro-3-oxobutyrate;4,4-Difluoro-3-oxobutanoic acid ethyl ester;4,4-Difluoro-3-oxobutyric acid ethyl ester;4,4-Difluoroacetoacetic acid ethyl ester
CAS NO.:352-24-9
Empirical Formula: C6H8F2O3
Molecular Weight: 166.12
MDL number: MFCD00039277
EINECS: 206-519-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB71.20 | In Stock |
|
| 100g | RMB239.20 | In Stock |
|
| 500g | RMB999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -46°C(lit.) |
| Boiling point: | 162 °C |
| Density | 1,61 g/cm3 |
| refractive index | 1.407 |
| Flash point: | 68℃ |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | 8.61±0.46(Predicted) |
| form | clear liquid |
| color | Colorless to Almost colorless |
| InChI | InChI=1S/C6H8F2O3/c1-2-11-5(10)3-4(9)6(7)8/h6H,2-3H2,1H3 |
| InChIKey | CBDPWKVOPADMJC-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)CC(=O)C(F)F |
| CAS DataBase Reference | 352-24-9(CAS DataBase Reference) |
| EPA Substance Registry System | Ethyl 4,4-difluoroacetoacetate (352-24-9) |
Description and Uses
Ethyl 4,4-Difluoroacetoacetate is an intermediate used for the synthesis of pharmaceuticals such as potassium channel activators and β-alanine derived GABA-T antagonists.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H226 |
| Precautionary statements | P305+P351+P338-P210-P280a-P303+P361+P353-P501a |
| Hazard Codes | F,Xi |
| Risk Statements | 10-36/37/38-36/38 |
| Safety Statements | 26-36/37/39 |
| RIDADR | 1993 |
| WGK Germany | 3 |
| Hazard Note | Flammable |
| TSCA | TSCA listed |
| HazardClass | IRRITANT, FLAMMABLE |
| HazardClass | 3 |
| HS Code | 2918300090 |







