A4031312
Epichlorohydrin-d5 , 98atom%D,98% , 69533-54-6
Synonym(s):
3-(Chloromethyl-d2)oxirane-2,2,3-d3
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB2399.20 | In Stock |
|
| 1G | RMB5599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | −57 °C(lit.) |
| Boiling point: | 115-117 °C(lit.) |
| Density | 1.247 g/mL at 25 °C |
| refractive index | n |
| Flash point: | 93 °F |
| solubility | Chloroform (Soluble), Methanol (Slightly) |
| form | Oil |
| color | Colourless |
| InChI | 1S/C3H5ClO/c4-1-3-2-5-3/h3H,1-2H2/i1D2,2D2,3D |
| InChIKey | BRLQWZUYTZBJKN-UXXIZXEISA-N |
| SMILES | [2H]C([2H])(Cl)C1([2H])OC1([2H])[2H] |
| CAS Number Unlabeled | 106-89-8 |
Description and Uses
Epichlorohydrin-d5 is used as a solvent for natural and synthetic resins, gums, cellulose esters and ethers, paints, varnishes, nail enamels and lacquers, cement for Celluloid. Also, it is used as stabilizer.
Safety
| Symbol(GHS) | ![]() ![]() ![]() ![]() GHS02,GHS05,GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H226-H301+H311+H331-H314-H317-H350 |
| Precautionary statements | P201-P210-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | T |
| Risk Statements | 45-10-23/24/25-34-43 |
| Safety Statements | 53-45 |
| RIDADR | UN 2023 6.1/PG 2 |
| WGK Germany | 3 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Carc. 1B Eye Dam. 1 Flam. Liq. 3 Skin Corr. 1B Skin Sens. 1 |






