A4033812
Ethyl 3-coumarincarboxylate , ≥98% , 1846-76-0
CAS NO.:1846-76-0
Empirical Formula: C12H10O4
Molecular Weight: 218.21
MDL number: MFCD00016964
EINECS: 811-043-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB84.80 | In Stock |
|
| 5G | RMB232.80 | In Stock |
|
| 25G | RMB1004.80 | In Stock |
|
| 100G | RMB3710.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 92-94 °C (lit.) |
| Boiling point: | 278.88°C (rough estimate) |
| Density | 1.1096 (rough estimate) |
| refractive index | 1.4270 (estimate) |
| storage temp. | Store at -20°C |
| solubility | Soluble in DMSO |
| form | powder to crystal |
| color | White to Almost white |
| λmax | 334nm(CH2Cl2)(lit.) |
| BRN | 200147 |
| InChI | 1S/C12H10O4/c1-2-15-11(13)9-7-8-5-3-4-6-10(8)16-12(9)14/h3-7H,2H2,1H3 |
| InChIKey | XKHPEMKBJGUYCM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=Cc2ccccc2OC1=O |
| CAS DataBase Reference | 1846-76-0(CAS DataBase Reference) |
Description and Uses
Ethyl 3-coumarincarboxylate is a coumarin derivative. Ethyl 3-coumarincarboxylate can be used as a pseudo-template to give a molecularly imprinted polymer (MIP) that has a fairly specific recognition capability for aflatoxins[1].
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H302-H371-H370-H372-H373-H341-H411 |
| Precautionary statements | P501-P273-P260-P270-P202-P201-P264-P280-P391-P308+P311-P301+P312+P330-P405 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| RTECS | DJ2501000 |
| HazardClass | IRRITANT |
| HS Code | 29322090 |
| Storage Class | 11 - Combustible Solids |








