A4034312
Ethyl (4-bromobenzoyl)acetate , ≥95.0% , 26510-95-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB104.80 | In Stock |
|
| 5G | RMB328.80 | In Stock |
|
| 25g | RMB1239.20 | In Stock |
|
| 100g | RMB4228.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 268-269 °C(lit.) |
| Density | 1.432 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | Liquid |
| pka | 9.56±0.25(Predicted) |
| color | Clear yellow |
| InChI | 1S/C11H11BrO3/c1-2-15-11(14)7-10(13)8-3-5-9(12)6-4-8/h3-6H,2,7H2,1H3 |
| InChIKey | PBDYXCKRDRCJDC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)c1ccc(Br)cc1 |
| CAS DataBase Reference | 26510-95-2(CAS DataBase Reference) |
Description and Uses
Ethyl (4-bromobenzoyl)acetate may be used to synthesize 2-(carboethoxy)-3-(4′-bromo)phenylquinoxaline 1,4-dioxide.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 29183000 |
| Storage Class | 10 - Combustible liquids |






