A4099812
Ethyl [bis(2,2,2-<WBR>trifluoroethoxy)<WBR>phosphinyl]<WBR>acetate , 96% , 124755-24-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB132.80 | In Stock |
|
| 5G | RMB410.40 | In Stock |
|
| 25G | RMB1999.20 | In Stock |
|
| 100g | RMB6399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 249-250 °C(lit.) |
| Density | 1.403 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 2-8°C, stored under nitrogen |
| Appearance | Colorless to light yellow Liquid |
| InChI | InChI=1S/C8H11F6O5P/c1-2-17-6(15)3-20(16,18-4-7(9,10)11)19-5-8(12,13)14/h2-5H2,1H3 |
| InChIKey | HBYHPBCAZBLFTD-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)CP(OCC(F)(F)F)(OCC(F)(F)F)=O |
Description and Uses
Ethyl [Bis(2,2,2-trifluoroethoxy)phosphinyl]acetate is a reagent used in the preparation of spiroketal EBC-23; an anticancer agent, scytonemin A; a novel calcium antagonist and other useful organic compounds.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |

![Ethyl [bis(2,2,2-<WBR>trifluoroethoxy)<WBR>phosphinyl]<WBR>acetate](https://img.chemicalbook.com/CAS/GIF/124755-24-4.gif)




![ETHYL 2-[BIS(2,2,2-TRIFLUOROETHYL)PHOSPHONO] PROPIONATE](https://img.chemicalbook.com/CAS/GIF/107905-52-2.gif)