A4183512
2-Ethylbenzofuran , 98% , 3131-63-3
CAS NO.:3131-63-3
Empirical Formula: C10H10O
Molecular Weight: 146.19
MDL number: MFCD00047287
EINECS: 221-524-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB79.20 | In Stock |
|
| 5G | RMB360.00 | In Stock |
|
| 25G | RMB1272.00 | In Stock |
|
| 100G | RMB3752.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 217-218 °C(Press: 742 Torr) |
| Density | 1.050±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Sparingly), Ethyl Acetate (Sparingly) |
| form | Oil |
| color | Yellow |
| InChI | InChI=1S/C10H10O/c1-2-9-7-8-5-3-4-6-10(8)11-9/h3-7H,2H2,1H3 |
| InChIKey | KJHYAEZMOHLVCH-UHFFFAOYSA-N |
| SMILES | O1C2=CC=CC=C2C=C1CC |
| LogP | 3.955 (est) |
| CAS DataBase Reference | 3131-63-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Ethyl-2-benzofuran(3131-63-3) |
| EPA Substance Registry System | Benzofuran, 2-ethyl- (3131-63-3) |
Description and Uses
2-Ethylbenzofuran is used in the synthesis of benzofurans as potential antianginal agents. They are also used in the preparation of 2-arylpyridines that are used in the synthesis of complexes with physical properties.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| TSCA | TSCA listed |
| HS Code | 2932990090 |





