A4215712
Ethyl azidoacetate solution , 95% , 637-81-0
CAS NO.：637-81-0
Empirical Formula: C4H7N3O2
Molecular Weight: 129.12
MDL number: MFCD00190177
EINECS: 211-301-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB45.60 | In Stock |
|
| 5G | RMB164.00 | In Stock |
|
| 25G | RMB653.60 | In Stock |
|
| 100G | RMB3023.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 44-46°C 2mm |
| Density | 1.12g/ml |
| refractive index | 1.4330 to 1.4370 |
| Flash point: | 25 °C |
| storage temp. | Refrigerator, under inert atmosphere |
| solubility | Chloroform (Sparingly), Ethyl Acetate (Slightly) |
| form | Oil |
| color | Colourless to Pale Yellow |
| BRN | 4247209 |
| InChI | InChI=1S/C4H7N3O2/c1-2-9-4(8)3-6-7-5/h2-3H2,1H3 |
| InChIKey | HVJJYOAPXBPQQV-UHFFFAOYSA-N |
| SMILES | C(=O)(OCC)CN=[N+]=[N-] |
| CAS DataBase Reference | 637-81-0(CAS DataBase Reference) |
Description and Uses
Ethyl Azidoacetate is an important organic substance that can undergo cyclisation reactions and is commonly used in the field of chemical synthesis.The condensation of 1-methyl-β-carboline-3-carbaldehyde with ethyl azidoacetate can be used to prepare 2-formylxanthine derivatives[1].
Safety
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H315-H319-H336-H351 |
| Precautionary statements | P201-P302+P352-P305+P351+P338-P308+P313 |
| Hazard Codes | Xn,Xi,C,F |
| Risk Statements | 1-40-36/37/38-10-67-65-63-48/20-38-11 |
| Safety Statements | 7-16-26-35-36-47-62-45-36/37 |
| RIDADR | UN 1593 6.1/PG 3 |
| WGK Germany | 2 |
| Hazard Note | Irritant/Corrosive |
| HS Code | 2929.90.5090 |
| HazardClass | 3 |
| PackingGroup | III |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
