A4272320
Clindamycin hydrochloride , ≥97.0% , 21462-39-5
Synonym(s):
(7S)-7-Chloro-7-deoxylincomycin hydrochloride monohydrate;(7S)-7-Chloro-7-deoxylincomycin hydrochloride;Cleocin;Clindamycin hydrochloride monohydrate
CAS NO.：21462-39-5
Empirical Formula: C18H34Cl2N2O5S
Molecular Weight: 461.44
MDL number: MFCD07793327
EINECS: 244-398-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB39.20 | In Stock |
|
| 5g | RMB89.60 | In Stock |
|
| 25g | RMB243.20 | In Stock |
|
| 100g | RMB795.20 | In Stock |
|
| 500g | RMB2799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 141°C |
| storage temp. | 2-8°C |
| solubility | H2O: 50 mg/mL, clear, colorless |
| form | Solid |
| color | White to Off-White |
| Water Solubility | H2O: 50mg/mL |
| BRN | 4070786 |
| Stability: | Hygroscopic |
| InChIKey | AUODDLQVRAJAJM-XJQDNNTCSA-N |
| SMILES | [C@@H]1([C@@H]([C@H](C)Cl)NC(=O)[C@@H]2C[C@@H](CCC)CN2C)[C@H](O)[C@H](O)[C@H]([C@@H](SC)O1)O.Cl |&1:0,1,2,8,10,17,19,21,22,r| |
| CAS DataBase Reference | 21462-39-5(CAS DataBase Reference) |
Description and Uses
Labelled Clindamycin. Semi-synthetic antibiotic prepared from Lincomycin;Labeled Clindamycin, intended for use as an internal standard for the quantification of Clindamycin by GC- or LC-mass spectrometry.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H317-H319-H362 |
| Precautionary statements | P260-P263-P280-P302+P352-P305+P351+P338-P308+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 2 |
| RTECS | GF2275000 |
| F | 10 |
| HS Code | 29419000 |
