A4276120
Cobalt(II) Tetraphenylporphyrin , 95% , 14172-90-8
Synonym(s):
Cobalt TPP
CAS NO.:14172-90-8
Empirical Formula: C44H28CoN4
Molecular Weight: 671.65
MDL number: MFCD00010725
EINECS: 238-018-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB388.80 | In Stock |
|
| 5g | RMB1263.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C (dec.) |
| Density | 1.20 g/cm3 |
| storage temp. | Inert atmosphere,Room Temperature |
| form | crystal |
| color | rust colored |
| λmax | 528nm(CH2Cl2)(lit.) |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChIKey | LSZLYWSRWXFMOI-DAJBKUBHSA-N |
| SMILES | N12[Co]N3C4C=CC3=C(C3C=CC(N=3)=C(C3=CC=CC=C3)C1=CC=C2C(C1=CC=CC=C1)=C1C=CC(C=4C2=CC=CC=C2)=N1)C1=CC=CC=C1 |c:7,14,41,t:36| |
| CAS DataBase Reference | 14172-90-8 |
Description and Uses
Co(II) meso-Tetraphenylporphine is used in the decomposition of substituted cycloheptatriene endoperoxides.
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Warning |
| Hazard statements | H351 |
| Precautionary statements | P201-P202-P281-P308+P313-P405-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |




![(SP-4-1)-[[4,4',4'',4'''-(21H,23H-Porphine-5,10,15,20-tetrayl-κN21,κN22,κN23,κN24)tetrakis[benzenaminato]](2-)]cobalt](https://img.chemicalbook.com/CAS/GIF/67201-98-3.gif)
![[5,10,15,20-Tetrakis(4-methoxyphenyl)porphyrinato]cobalt(II)](https://img.chemicalbook.com/CAS/GIF/28903-71-1.gif)
