A4281520
4,6-Difluoroisatin , 98% , 126674-93-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB68.80 | In Stock |
|
| 5g | RMB200.00 | In Stock |
|
| 25g | RMB498.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 218-220 °C |
| Density | 1.578 |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 7.65±0.20(Predicted) |
| Appearance | Light yellow to green yellow Solid |
| InChI | InChI=1S/C8H3F2NO2/c9-3-1-4(10)6-5(2-3)11-8(13)7(6)12/h1-2H,(H,11,12,13) |
| InChIKey | YIVXDNUTNIKQMY-UHFFFAOYSA-N |
| SMILES | N1C2=C(C(F)=CC(F)=C2)C(=O)C1=O |
| LogP | 1.13 |
Description and Uses
4,6-DIFLUOROINDOLINE-2, 3-dione, also known as 4,6-difluoroisatin, is a fluorinated derivative of indole. It is primarily used as a synthetic intermediate in the production of specialised pharmaceuticals and agrochemicals, such as anti-cancer Kras G12C inhibitors and CRHR2 antagonists for the treatment of chronic heart failure.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264b-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P362+P364-P403+P233-P501c |
| HS Code | 2933998090 |







