A4282212
3-Fluorophenylhydrazine hydrochloride , 97% , 2924-16-5
CAS NO.：2924-16-5
Empirical Formula: C6H8ClFN2
Molecular Weight: 162.59
MDL number: MFCD00012934
EINECS: 220-886-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB31.20 | In Stock |
|
| 25G | RMB114.40 | In Stock |
|
| 100G | RMB370.40 | In Stock |
|
| 500g | RMB1803.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 268 °C (dec.)(lit.) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Chloroform : DMSO = 1 : 1 (Slightly), Methanol (Slightly) |
| form | Powder |
| color | White to light brown |
| BRN | 3627729 |
| InChI | InChI=1S/C6H7FN2.ClH/c7-5-2-1-3-6(4-5)9-8;/h1-4,9H,8H2;1H |
| InChIKey | SKVGLOFWEJFQKU-UHFFFAOYSA-N |
| SMILES | C1(NN)=CC=CC(F)=C1.Cl |
| CAS DataBase Reference | 2924-16-5(CAS DataBase Reference) |
Description and Uses
3-Fluorophenylhydrazine Hydrochloride can be used to synthesize compounds that are useful for the prophylaxis and treatment of pro-inflammatory cytokine mediated diseases, and in particular, p38 activity mediated inflammation and related conditions.
Safety
| Symbol(GHS) |   GHS07,GHS06 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335-H301 |
| Precautionary statements | P261-P280-P305+P351+P338-P280a-P301+P310a-P405-P501a |
| Hazard Codes | Xn,Xi,T |
| Risk Statements | 20/21/22-36/37/38-43-40-23/24/25 |
| Safety Statements | 26-37/39-45-36/37-36 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| PackingGroup | III |
| HS Code | 29280000 |
