A4289212
Fmoc-ß-Ala-OH , 99% , 35737-10-1
Synonym(s):
Fmoc-β-alanine
| Pack Size | Price | Stock | Quantity |
| 1g | RMB27.20 | In Stock |
|
| 5G | RMB36.80 | In Stock |
|
| 25G | RMB121.60 | In Stock |
|
| 100G | RMB378.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 142-147 °C |
| Boiling point: | 451.38°C (rough estimate) |
| Density | 1.2626 (rough estimate) |
| refractive index | 1.5100 (estimate) |
| storage temp. | 2-8°C |
| solubility | Soluble in water or 1% acetic acid |
| form | powder to crystal |
| pka | 4.41±0.10(Predicted) |
| color | White to Almost white |
| Water Solubility | Soluble in water and 1% acetic acid. |
| BRN | 2302327 |
| Major Application | peptide synthesis |
| InChI | 1S/C18H17NO4/c20-17(21)9-10-19-18(22)23-11-16-14-7-3-1-5-12(14)13-6-2-4-8-15(13)16/h1-8,16H,9-11H2,(H,19,22)(H,20,21) |
| InChIKey | LINBWYYLPWJQHE-UHFFFAOYSA-N |
| SMILES | OC(=O)CCNC(=O)OCC1c2ccccc2-c3ccccc13 |
| CAS DataBase Reference | 35737-10-1(CAS DataBase Reference) |
Description and Uses
It is an important raw material and intermediate used in organic synthesis, pharmaceuticals, agrochemicals and dyestuffs.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H335-H315 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 2924 29 70 |
| HazardClass | IRRITANT |
| Storage Class | 11 - Combustible Solids |
