A4293412
Fisetin , 98% , 528-48-3
Synonym(s):
3,3′,4′,7-Tetrahydroxyflavone;3,3′,4′,7-Tetra-hydroxy-flavone;5-Deoxyquercetin;5-Desoxyquercetin;Cotinin
CAS NO.:528-48-3
Empirical Formula: C15H10O6
Molecular Weight: 286.24
MDL number: MFCD00006829
EINECS: 208-434-4
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB120.00 | In Stock |
|
| 250MG | RMB287.20 | In Stock |
|
| 500MG | RMB471.20 | In Stock |
|
| 1G | RMB806.40 | In Stock |
|
| 5G | RMB2808.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >330 °C(lit.) |
| Boiling point: | 348.61°C (rough estimate) |
| Density | 1.2981 (rough estimate) |
| refractive index | 1.4413 (estimate) |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| Colour Index | 75620 |
| pka | 6.83±0.40(Predicted) |
| form | Solid |
| color | Pale Yellow to Very Dark Yellow |
| Merck | 14,4088 |
| BRN | 292829 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C15H10O6/c16-8-2-3-9-12(6-8)21-15(14(20)13(9)19)7-1-4-10(17)11(18)5-7/h1-6,16-18,20H |
| InChIKey | XHEFDIBZLJXQHF-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=C(O)C(O)=C2)OC2=CC(O)=CC=C2C(=O)C=1O |
| LogP | 1.970 (est) |
| EPA Substance Registry System | Fisetin (528-48-3) |
Description and Uses
Fisetin, a well-known plant flavonol from natural flavonoid group, is found in traditional medicines, plants, vegetables, fruits. Fisetin also has anti-oxidant, anti-inflammatory, anti-tumor effects[1].
Fisetin is used in biological studies as spleen tyrosine kinase inhibitors for autoimmune inflammation disease. This compound has neuroprotective properties.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| RTECS | LK9250000 |
| F | 10 |
| TSCA | Yes |
| HS Code | 29329990 |





