A4299712
Fmoc-Arg-OH , 98% , 91000-69-0
Synonym(s):
Nα-Fmoc-L -arginine;Nα-(9-Fluorenylmethoxycarbonyl)-L -arginine
| Pack Size | Price | Stock | Quantity |
| 1G | RMB28.00 | In Stock |
|
| 5G | RMB66.40 | In Stock |
|
| 25G | RMB313.60 | In Stock |
|
| 100G | RMB1119.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 145-150 °C(lit.) |
| alpha | 9 º (c=1 DMF 24 ºC) |
| Boiling point: | 520.14°C (rough estimate) |
| Density | 1.2722 (rough estimate) |
| refractive index | 1.6620 (estimate) |
| storage temp. | 2-8°C |
| solubility | Aqueous Acid (Slightly), Chloroform (Slightly), Dimethylformamide (Slightly) |
| form | Powder |
| pka | 3.81±0.21(Predicted) |
| color | Off-white |
| optical activity | [α]/D +9.0±2.0°, c = 1% in DMF |
| Sensitive | Moisture Sensitive |
| BRN | 4828015 |
| InChIKey | DVBUCBXGDWWXNY-SFHVURJKSA-N |
| SMILES | C(O)(=O)[C@H](CCCNC(N)=N)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |
| CAS DataBase Reference | 91000-69-0(CAS DataBase Reference) |
Description and Uses
Nα-Fmoc-L-arginine is an N-Fmoc-protected form of L-Arginine (A769505). L-Arginine is an conditionally essential amino acid for humans and adult mammals as it’s requirements exceed production during certain developmental stages in life (such as pregnancy). L-Arginine also prevents blood toxicity from intravenous amino acid administration in humans.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H319-H335-H315 |
| Precautionary statements | P264-P270-P301+P312-P330-P501-P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 21 |
| HS Code | 29252900 |
