A4300712
Fmoc-Nle-OH , 98% , 77284-32-3
Synonym(s):
Fmoc-Nle-OH;N-α-Fmoc-L-norleucine;(S)-2-(Fmoc-amino)caproic acid;(S)-2-(Fmoc-amino)hexanoic acid;N-(9-Fluorenylmethoxycarbonyl)-L -norleucine
| Pack Size | Price | Stock | Quantity |
| 1g | RMB31.20 | In Stock |
|
| 5G | RMB96.80 | In Stock |
|
| 25G | RMB306.40 | In Stock |
|
| 100g | RMB1199.20 | In Stock |
|
| 500g | RMB5039.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 141-144 °C(lit.) |
| alpha | -18.5 º (C=1 IN DMF) |
| Boiling point: | 565.6±33.0 °C(Predicted) |
| Density | 1.209±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| pka | 3.91±0.21(Predicted) |
| form | Crystalline Powder |
| color | White to off-white |
| optical activity | [α]20/D 18±1°, c = 1% in DMF |
| BRN | 5305164 |
| Major Application | peptide synthesis |
| InChI | 1S/C21H23NO4/c1-2-3-12-19(20(23)24)22-21(25)26-13-18-16-10-6-4-8-14(16)15-9-5-7-11-17(15)18/h4-11,18-19H,2-3,12-13H2,1H3,(H,22,25)(H,23,24)/t19-/m0/s1 |
| InChIKey | VCFCFPNRQDANPN-IBGZPJMESA-N |
| SMILES | CCCC[C@H](NC(=O)OCC1c2ccccc2-c3ccccc13)C(O)=O |
| CAS DataBase Reference | 77284-32-3(CAS DataBase Reference) |
Description and Uses
Fmoc-Nle-OH, is an amino acid derivative used in chemical synthesis and peptide chemistry.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264b-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P362+P364-P403+P233-P501c |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 2924 29 70 |
| HazardClass | IRRITANT |
| Storage Class | 13 - Non Combustible Solids |







