A4314212
Nα-Fmoc-Nε-trifluoroacetyl-L-lysine , 96% , 76265-69-5
CAS NO.:76265-69-5
Empirical Formula: C23H23F3N2O5
Molecular Weight: 464.43
MDL number: MFCD00153360
| Pack Size | Price | Stock | Quantity |
| 1G | RMB103.20 | In Stock |
|
| 5G | RMB252.80 | In Stock |
|
| 25G | RMB1151.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 170-174℃ |
| Boiling point: | 668.3±55.0 °C(Predicted) |
| Density | 1.336±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| pka | 3.86±0.21(Predicted) |
| form | Solid |
| color | White to off-white |
| optical activity | Consistent with structure |
| Major Application | peptide synthesis |
| InChIKey | ZVLMWTPNDXNXSZ-IBGZPJMESA-N |
| SMILES | FC(F)(F)C(=O)NCCCC[C@H](NC(=O)OCC1c2c(cccc2)c3c1cccc3)C(=O)O |
| CAS DataBase Reference | 76265-69-5(CAS DataBase Reference) |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| WGK Germany | 3 |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |






