A4314812
Fmoc-Tyr-OH , 97% , 92954-90-0
Synonym(s):
Nα-Fmoc-L -tyrosine;Fmoc-Tyr-OH;N-α-Fmoc-L-tyrosine
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.80 | In Stock |
|
| 5G | RMB56.00 | In Stock |
|
| 25G | RMB152.00 | In Stock |
|
| 100G | RMB580.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 182-187 °C |
| alpha | -22 º (c=1%, DMF) |
| Boiling point: | 672.6±55.0 °C(Predicted) |
| Density | 1.336±0.06 g/cm3(Predicted) |
| refractive index | -22.0 ° (C=1, DMF) |
| storage temp. | 2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 2.95±0.10(Predicted) |
| color | White to Almost white |
| optical activity | [α]20/D 22±2°, c = 1% in DMF |
| BRN | 3573123 |
| Major Application | peptide synthesis |
| InChI | 1S/C24H21NO5/c26-16-11-9-15(10-12-16)13-22(23(27)28)25-24(29)30-14-21-19-7-3-1-5-17(19)18-6-2-4-8-20(18)21/h1-12,21-22,26H,13-14H2,(H,25,29)(H,27,28)/t22-/m0/s1 |
| InChIKey | SWZCTMTWRHEBIN-QFIPXVFZSA-N |
| SMILES | OC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)OCC2c3ccccc3-c4ccccc24 |
| CAS DataBase Reference | 92954-90-0(CAS DataBase Reference) |
Description and Uses
N-Fmoc-L-tyrosine is an N-Fmoc-protected form of L-Tyrosine. L-Tyrosine is an essential amino acid that exhibits in vitro antioxidant and antiradical activities. L-Tyrosine is used as a precursor to synthesize catecholamines (e.g. Norepinephrine HCl [N674500]) in human keratinocytes, and also for the synthesis of proteins and thyroid hormones.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-36/37/39-27-26 |
| WGK Germany | 3 |
| HS Code | 2924 29 70 |
| Storage Class | 13 - Non Combustible Solids |
