A4315212
Fmoc-D-Val-OH , 98% , 84624-17-9
Synonym(s):
N-(9-Fluorenylmethoxycarbonyl)-D -valine;Fmoc-D -valine;Fmoc-D-Val-OH;N-α-Fmoc-D-valine
CAS NO.:84624-17-9
Empirical Formula: C20H21NO4
Molecular Weight: 339.39
MDL number: MFCD00062953
EINECS: 1533716-785-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB28.80 | In Stock |
|
| 25G | RMB76.00 | In Stock |
|
| 100g | RMB298.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 143-144 °C(lit.) |
| alpha | 17 º (c=1, DMF) |
| Boiling point: | 551.8±33.0 °C(Predicted) |
| Density | 1.229±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), DMF (Slightly), DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 3.90±0.10(Predicted) |
| color | White |
| optical activity | Consistent with structure |
| Water Solubility | Solubility in methanol (almost transparency). Slightly soluble in water. |
| BRN | 6489548 |
| Major Application | peptide synthesis |
| InChI | 1S/C20H21NO4/c1-12(2)18(19(22)23)21-20(24)25-11-17-15-9-5-3-7-13(15)14-8-4-6-10-16(14)17/h3-10,12,17-18H,11H2,1-2H3,(H,21,24)(H,22,23)/t18-/m1/s1 |
| InChIKey | UGNIYGNGCNXHTR-GOSISDBHSA-N |
| SMILES | CC(C)[C@@H](NC(=O)OCC1c2ccccc2-c3ccccc13)C(O)=O |
| CAS DataBase Reference | 84624-17-9(CAS DataBase Reference) |
Description and Uses
N-Fmoc-D-valine is an N-Fmoc-protected form of D-Valine (V094200). D-Valine (an isomer of the essential amino acid L-Valine [V094205])exhibited inhibitory effects on fibroblasts that contaminated mammalian kidney cultures, allowing for selective growth epithelial cells. D-Valine is also known for its presence in the structure of Actinomycin D, an antitumour drug. D-Valine is naturally synthesized by Streptomyces antibioticus.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H335-H319 |
| Precautionary statements | P271-P261-P280-P403+P233 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 2924 29 70 |
| Storage Class | 11 - Combustible Solids |






