A4320912
FMOC-L-4-Fluorophe , 98% , 169243-86-1
Synonym(s):
N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-4-fluoro-L -phenylalanine;Fmoc-4-fluoro-L -phenylalanine;Fmoc-Phe(4-F)-OH;N-α-Fmoc-4-fluoro-L-phenylalanine
| Pack Size | Price | Stock | Quantity |
| 1G | RMB70.40 | In Stock |
|
| 5G | RMB278.40 | In Stock |
|
| 25G | RMB1439.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 185.4 °C |
| alpha | -35 º (c=1,DMF) |
| Boiling point: | 623.9±55.0 °C(Predicted) |
| Density | 1.2642 (estimate) |
| storage temp. | 2-8°C |
| solubility | Soluble in Dimethylformamide(DMF). |
| pka | 3.75±0.10(Predicted) |
| form | solid |
| color | White to Almost white |
| optical activity | 39.4043° (C=1.0004 g/100ml, DMF) |
| BRN | 8287377 |
| InChIKey | IXUMACXMEZBPJG-QFIPXVFZSA-N |
| SMILES | C(O)(=O)[C@H](CC1=CC=C(F)C=C1)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |
| CAS DataBase Reference | 169243-86-1 |
Description and Uses
4-Fluoro-N-Fmoc-L-phenylalanine derivative was introduced in collaboration with Yu and coworkers in reflection to a methodology reported in C-H Activation. It is also used as pharmaceutical intermediate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-22-28-26 |
| WGK Germany | WGK 2 water endangering |
| Hazard Note | Harmful |
| HS Code | 29223990 |







