A6247612
N-Fmoc-4-methoxy-L-phenylalanine , 95% , 77128-72-4
Synonym(s):
Fmoc-Tyr(Me)-OH;N-α-Fmoc-O-methyl-L-tyrosine
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB31.20 | In Stock |
|
| 1G | RMB87.20 | In Stock |
|
| 5G | RMB277.60 | In Stock |
|
| 25g | RMB870.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 161 °C |
| Boiling point: | 647.8±55.0 °C(Predicted) |
| Density | 1.274±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| form | powder to crystal |
| pka | 2.97±0.10(Predicted) |
| color | White to Almost white |
| optical activity | -26.3° (C=0.01 g/ml, DMF) |
| Major Application | peptide synthesis |
| InChIKey | JYQODLWFOPCSCS-QHCPKHFHSA-N |
| SMILES | C(O)(=O)[C@H](CC1=CC=C(OC)C=C1)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |
| CAS DataBase Reference | 77128-72-4(CAS DataBase Reference) |
Description and Uses
Fmoc-Tyr(Me)-OH, also known as Fmoc-O-methyl-L-tyrosine, is an Fmoc protected tyrosine derivative that is potentially useful for proteomics studies and solid phase peptide synthesis techniques. Tyrosine is a important amino acid - one of the few amino acids which is phosphorylated to vary the physical properties of the peptides, and is a precursor for the formation of iodinated thyroid hormones. The Fmoc group is typically removed with a base such as pyridine - an orthogonal de-protection strategy to the acid labilie Boc group.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H335-H315 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| WGK Germany | WGK 2 water endangering |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |







