A4289712
Fmoc-4-Iodo-L-phenylalanine , 97% , 82565-68-2
Synonym(s):
Fmoc-4-iodo-L -phenylalanine
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB35.20 | In Stock |
|
| 1G | RMB67.20 | In Stock |
|
| 5G | RMB245.60 | In Stock |
|
| 25G | RMB980.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 213-217 °C(lit.) |
| alpha | -10 º (c=1 in DMF) |
| Boiling point: | 658.8±55.0 °C(Predicted) |
| Density | 1.577±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Powder |
| pka | 3.73±0.10(Predicted) |
| color | White to off-white |
| Sensitive | Light Sensitive |
| BRN | 4592723 |
| Major Application | peptide synthesis |
| InChI | 1S/C24H20INO4/c25-16-11-9-15(10-12-16)13-22(23(27)28)26-24(29)30-14-21-19-7-3-1-5-17(19)18-6-2-4-8-20(18)21/h1-12,21-22H,13-14H2,(H,26,29)(H,27,28)/t22-/m0/s1 |
| InChIKey | LXOXXTQKKRJNNB-QFIPXVFZSA-N |
| SMILES | OC(=O)[C@H](Cc1ccc(I)cc1)NC(=O)OCC2c3ccccc3-c4ccccc24 |
| CAS DataBase Reference | 82565-68-2(CAS DataBase Reference) |
Description and Uses
Synthesis of a phosphotyrosine mimetic
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P271-P261-P280 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 8 |
| HazardClass | IRRITANT |
| HS Code | 2922498590 |
| Storage Class | 11 - Combustible Solids |
