A4370412
Fmoc-Phe(4-CN)-OH , ≥98% , 173963-93-4
Synonym(s):
Fmoc-4-cyano-L -phenylalanine;Fmoc-4-cyanophenylalanine
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB82.80 | In Stock |
|
| 1G | RMB254.88 | In Stock |
|
| 5G | RMB613.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 189 °C |
| Boiling point: | 531.88°C (rough estimate) |
| Density | 1.2691 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| storage temp. | 2-8°C |
| form | Solid |
| pka | 3.62±0.10(Predicted) |
| color | White to off-white |
| optical activity | Consistent with structure |
| BRN | 7500424 |
| Major Application | peptide synthesis |
| InChIKey | JOPKKUTWCGYCDA-QHCPKHFHSA-N |
| SMILES | OC(=O)[C@H](Cc1ccc(cc1)C#N)NC(=O)OCC2c3ccccc3-c4ccccc24 |
| CAS DataBase Reference | 173963-93-4(CAS DataBase Reference) |
Description and Uses
Fmoc-L-4-cyanophenylalanine can be used as neuroprotective compounds.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Warning |
| Hazard statements | H301-H311-H332 |
| Precautionary statements | P261-P280h-P301+P310a-P304+P340-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22 |
| Safety Statements | 36/37 |
| WGK Germany | 3 |
| HS Code | 2926 90 70 |
| HazardClass | IRRITANT |
| Storage Class | 11 - Combustible Solids |







