BD3148245
Fmoc-Phe(4-CF3)-OH , 95% , 247113-86-6
Synonym(s):
Fmoc-4-(trifluoromethyl)-L -phenylalanine;Fmoc-Phe(4-CF3)-OH
CAS NO.:247113-86-6
Empirical Formula: C25H20F3NO4
Molecular Weight: 455.43
MDL number: MFCD00797581
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB65.60 | In Stock |
|
| 1g | RMB163.20 | In Stock |
|
| 5g | RMB804.80 | In Stock |
|
| 25g | RMB3628.80 | In Stock |
|
| 100g | RMB9072.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 128-138°C |
| Boiling point: | 619.0±55.0 °C(Predicted) |
| Density | 1.351±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 3.65±0.10(Predicted) |
| form | Powder |
| color | Pale brown |
| optical activity | [α]/D -37±2°, c = 1 in DMF |
| Major Application | peptide synthesis |
| InChIKey | YMEGJWTUWMVZPD-QFIPXVFZSA-N |
| SMILES | O=C(O)[C@@H](NC(OCC1C(C=CC=C2)=C2C3=C1C=CC=C3)=O)CC4=CC=C(C(F)(F)F)C=C4 |
Description and Uses
Phenylalanine derivative was introduced in collaboration with Yu and coworkers in reflection to a methodology reported in C-H Activation.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P280-P271 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| WGK Germany | 3 |
| Hazard Note | Harmful/Irritant/Keep Cold |
| HazardClass | IRRITANT |
| HS Code | 2922498590 |
| Storage Class | 11 - Combustible Solids |







