A6737612
Boc-3-(4-Pyridyl)-L-alanine , 97% , 37535-57-2
Synonym(s):
Boc-3-(4-pyridyl)-L -alanine
| Pack Size | Price | Stock | Quantity |
| 1G | RMB189.60 | In Stock |
|
| 250mg | RMB207.20 | In Stock |
|
| 5G | RMB766.40 | In Stock |
|
| 25G | RMB3279.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 409.5°C (rough estimate) |
| Density | 1.1738 (rough estimate) |
| refractive index | 1.6450 (estimate) |
| storage temp. | 2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Powder |
| pka | 3.43±0.10(Predicted) |
| color | White to light yellow |
| Sensitive | Air & Moisture Sensitive |
| BRN | 6417084 |
| Major Application | peptide synthesis |
| InChI | 1S/C13H18N2O4/c1-13(2,3)19-12(18)15-10(11(16)17)8-9-4-6-14-7-5-9/h4-7,10H,8H2,1-3H3,(H,15,18)(H,16,17)/t10-/m0/s1 |
| InChIKey | FNYWDMKESUACOU-JTQLQIEISA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccncc1)C(O)=O |
| CAS DataBase Reference | 37535-57-2(CAS DataBase Reference) |
Description and Uses
Boc-3-(4-pyridyl)-L-alanine is the protected form of L-Alanine (A481500), a non-essential amino acid that can be found naturally in the human body and is obtained by our diet.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P271-P280 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| WGK Germany | 3 |
| F | 1-10 |
| HazardClass | IRRITANT |
| HS Code | 2933399990 |
| Storage Class | 11 - Combustible Solids |






