A4595229
Boc-β-(4-thiazolyl)-Ala-OH , ≥98.0%(HPLC) , 119434-75-2
Synonym(s):
(S)-2-(Boc-amino)-3-(4-thiazolyl)propionic acid;Boc-3-(4-thiazolyl)-L -alanine
CAS NO.:119434-75-2
Empirical Formula: C11H16N2O4S
Molecular Weight: 272.32
MDL number: MFCD00079682
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB165.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 122℃ |
| Boiling point: | 456.8±40.0 °C(Predicted) |
| Density | 1.288 |
| refractive index | 1.5650 (estimate) |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| form | Powder |
| pka | 3.53±0.10(Predicted) |
| color | White to pale yellow-beige |
| Major Application | peptide synthesis |
| InChI | 1S/C11H16N2O4S/c1-11(2,3)17-10(16)13-8(9(14)15)4-7-5-18-6-12-7/h5-6,8H,4H2,1-3H3,(H,13,16)(H,14,15)/t8-/m0/s1 |
| InChIKey | RVXBTZJECMMZSB-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1cscn1)C(O)=O |
| CAS DataBase Reference | 119434-75-2(CAS DataBase Reference) |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P271-P260-P280 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29223900 |
| Storage Class | 11 - Combustible Solids |






