A4322012
Fmoc-N-methyl-L-aspartic acid 4-tert-butyl ester , 98% , 152548-66-8
Synonym(s):
N-Methyl aspartic acid;Fmoc-N-Me-Asp(OtBu)-OH;N-α-Fmoc-N-α-methyl-L-aspartic acid β-tert butyl ester
CAS NO.:152548-66-8
Empirical Formula: C24H27NO6
Molecular Weight: 425.47
MDL number: MFCD00237027
EINECS: 240-880-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB413.60 | In Stock |
|
| 5G | RMB1868.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 135-140°C |
| Boiling point: | 598.7±50.0 °C(Predicted) |
| Density | 1.237±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Soluble in water or 1% acetic acid |
| form | Powder |
| pka | 3.59±0.23(Predicted) |
| color | White to off-white |
| optical activity | [α]22/D -39.0°, c = 0.5% in DMF |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C24H27NO6/c1-24(2,3)31-21(26)13-20(22(27)28)25(4)23(29)30-14-19-17-11-7-5-9-15(17)16-10-6-8-12-18(16)19/h5-12,19-20H,13-14H2,1-4H3,(H,27,28)/t20-/m0/s1 |
| InChIKey | CYWWLVIEAOUXGW-FQEVSTJZSA-N |
| SMILES | C(O)(=O)[C@H](CC(OC(C)(C)C)=O)N(C(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O)C |
| CAS DataBase Reference | 152548-66-8(CAS DataBase Reference) |
Description and Uses
Fmoc protected N-methyl amino acid suitable for solid phase peptide synthesis. N-methyl amino acids have been shown to improve proteolytic stability of peptides.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | N |
| Risk Statements | 50/53 |
| Safety Statements | 60-61 |
| WGK Germany | 3 |
| HS Code | 2924 29 70 |
| HazardClass | IRRITANT |
| Storage Class | 11 - Combustible Solids |







