A4322112
Fmoc-N-methyl-L-glutamic acid 5-tert-butyl ester , 98% , 200616-40-6
Synonym(s):
N-Methyl glutamic acid
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB431.20 | In Stock |
|
| 1G | RMB912.00 | In Stock |
|
| 5G | RMB3181.60 | In Stock |
|
| 25G | RMB11999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 116-119°C |
| Boiling point: | 612.3±55.0 °C(Predicted) |
| Density | 1.220±0.06 g/cm3(Predicted) |
| storage temp. | Store at +2°C to +8°C. |
| solubility | Soluble in water or 1% acetic acid |
| form | Powder |
| pka | 3.72±0.10(Predicted) |
| color | White to off-white |
| Major Application | peptide synthesis |
| InChI | 1S/C25H29NO6/c1-25(2,3)32-22(27)14-13-21(23(28)29)26(4)24(30)31-15-20-18-11-7-5-9-16(18)17-10-6-8-12-19(17)20/h5-12,20-21H,13-15H2,1-4H3,(H,28,29)/t21-/m0/s1 |
| InChIKey | FVUASVBQADLDRO-NRFANRHFSA-N |
| SMILES | C(O)(=O)[C@H](CCC(OC(C)(C)C)=O)N(C(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O)C |
| CAS DataBase Reference | 200616-40-6(CAS DataBase Reference) |
Description and Uses
Fmoc-protected N-methyl amino acid. N-methyl amino acids have shown enhanced biological stability in peptides compared to standard amino acids.
