A4328212
6-Fluoro-1-indanone , 98% , 1481-32-9
CAS NO.:1481-32-9
Empirical Formula: C9H7FO
Molecular Weight: 150.15
MDL number: MFCD01318147
EINECS: 625-201-6
| Pack Size | Price | Stock | Quantity |
| 500mg | RMB23.20 | In Stock |
|
| 1G | RMB39.20 | In Stock |
|
| 5G | RMB111.20 | In Stock |
|
| 25G | RMB399.20 | In Stock |
|
| 100G | RMB1399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 56-60 °C |
| Boiling point: | 60 °C/0.07kPa |
| Density | 1.259±0.06 g/cm3(Predicted) |
| Flash point: | 60°C/0.5mm |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | Crystalline Powder |
| color | Off-white to pale brown |
| BRN | 1448695 |
| InChI | InChI=1S/C9H7FO/c10-7-3-1-6-2-4-9(11)8(6)5-7/h1,3,5H,2,4H2 |
| InChIKey | LVUUCFIQQHEFEJ-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C=CC(F)=C2)CC1 |
| CAS DataBase Reference | 1481-32-9(CAS DataBase Reference) |
Description and Uses
6-Fluoro-1-indanone is an intermediate compound that can be used as an organic synthesis raw material for the preparation of pharmaceutical and chemical products. It is also an excellent reaction reagent that can undergo various chemical reactions, including oxidation, reduction and substitution.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H302 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36-37 |
| WGK Germany | 2 |
| HazardClass | IRRITANT |
| HS Code | 29147000 |





