A4334312
5-Fluoro-2-nitrobenzaldehyde , 98% , 395-81-3
CAS NO.：395-81-3
Empirical Formula: C7H4FNO3
Molecular Weight: 169.11
MDL number: MFCD00153175
EINECS: 206-903-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB51.20 | In Stock |
|
| 25G | RMB198.40 | In Stock |
|
| 100G | RMB655.20 | In Stock |
|
| 500g | RMB2399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 92-94°C |
| Boiling point: | 153°C 23mm |
| Density | 1.443±0.06 g/cm3(Predicted) |
| Flash point: | >110°C |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| Water Solubility | Insoluble in water |
| form | powder to crystal |
| color | White to Light red to Green |
| Sensitive | Air Sensitive |
| BRN | 1869010 |
| InChI | InChI=1S/C7H4FNO3/c8-6-1-2-7(9(11)12)5(3-6)4-10/h1-4H |
| InChIKey | KKAFVHUJZPVWND-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC(F)=CC=C1[N+]([O-])=O |
| CAS DataBase Reference | 395-81-3(CAS DataBase Reference) |
Description and Uses
5-Fluoro-2-nitrobenzaldehyde can be used as an intermediate in pharmaceutical chemistry and organic synthesis, and is used to prepare herbicides, plant growth regulators, etc.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37 |
| HazardClass | IRRITANT |
| HS Code | 29124990 |
