A4345012
N-Fluorobenzenesulfonimide , 97% , 133745-75-2
Synonym(s):
N-Fluorodi(benzenesulfonyl)amine;N-Fluorodibenzenesulfonimide;NFSI
CAS NO.：133745-75-2
Empirical Formula: C12H10FNO4S2
Molecular Weight: 315.34
MDL number: MFCD00144885
EINECS: 000-000-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB48.80 | In Stock |
|
| 100G | RMB88.00 | In Stock |
|
| 500G | RMB400.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 114-116 °C |
| Boiling point: | 471.4±28.0 °C(Predicted) |
| Density | 1.4466 (estimate) |
| Flash point: | 110℃ |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Very soluble in acetonitrile, dichloromethane or THF and less soluble in toluene. |
| pka | -32.45±0.70(Predicted) |
| form | solid |
| color | white |
| BRN | 5348902 |
| InChI | InChI=1S/C12H10FNO4S2/c13-14(19(15,16)11-7-3-1-4-8-11)20(17,18)12-9-5-2-6-10-12/h1-10H |
| InChIKey | RLKHFSNWQCZBDC-UHFFFAOYSA-N |
| SMILES | C1(S(N(F)S(C2=CC=CC=C2)(=O)=O)(=O)=O)=CC=CC=C1 |
| CAS DataBase Reference | 133745-75-2(CAS DataBase Reference) |
Description and Uses
Versatile fluorinating reagent used in the fluorination of aryls, enolates, carbanions, organolithiums, etc.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,O |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| F | 10 |
| Hazard Note | Oxidising Agent |
| TSCA | No |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
