BD1095232
(4-Ethoxy-2,3-difluorophenyl)boronic acid , 97% , 212386-71-5
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB24.00 | In Stock |
|
| 1g | RMB65.60 | In Stock |
|
| 5g | RMB212.00 | In Stock |
|
| 10g | RMB348.00 | In Stock |
|
| 25g | RMB706.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 151-154 |
| Boiling point: | 316.0±52.0 °C(Predicted) |
| Density | 1.29 |
| vapor pressure | 0.002Pa at 25℃ |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | soluble in Methanol |
| form | Solid |
| pka | 7.69±0.58(Predicted) |
| color | White to Almost white |
| Water Solubility | 145mg/L at 20℃ |
| InChI | InChI=1S/C8H9BF2O3/c1-2-14-6-4-3-5(9(12)13)7(10)8(6)11/h3-4,12-13H,2H2,1H3 |
| InChIKey | OBKSFBWOZSQGGC-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(OCC)C(F)=C1F)(O)O |
| LogP | 2.3 at 23℃ |
Description and Uses
suzuki reaction
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| HazardClass | IRRITANT |
| HS Code | 2931900090 |







