BD1253748
(4-Chloro-2-fluoro-3-methoxyphenyl)boronicacid , 98% , 944129-07-1
CAS NO.：944129-07-1
Empirical Formula: C7H7BClFO3
Molecular Weight: 204.39
MDL number: MFCD17015742
EINECS: 628-589-5
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB120.80 | In Stock |
|
| 250mg | RMB181.60 | In Stock |
|
| 1g | RMB468.00 | In Stock |
|
| 5g | RMB1411.20 | In Stock |
|
| 10g | RMB2133.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 342.7±52.0 °C(Predicted) |
| Density | 1.40±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Dichloromethane; |
| pka | 7.71±0.58(Predicted) |
| form | Solid |
| color | White |
| InChI | InChI=1S/C7H7BClFO3/c1-13-7-5(9)3-2-4(6(7)10)8(11)12/h2-3,11-12H,1H3 |
| InChIKey | GDJCQSNQOHRAGY-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(Cl)C(OC)=C1F)(O)O |
Description and Uses
4-Chloro-2-fluoro-3-methoxyphenylboronic Acid is an intermediate in the synthesis of Arylex (A794890), which exhibits potent dicot weed control; Herbicide.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| HS Code | 2931900090 |
