A4347212
2-Fluoro-4-(trifluoromethyl)benzaldehyde , 98% , 89763-93-9
CAS NO.:89763-93-9
Empirical Formula: C8H4F4O
Molecular Weight: 192.11
MDL number: MFCD00061310
EINECS: 618-296-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB32.80 | In Stock |
|
| 5G | RMB117.60 | In Stock |
|
| 10g | RMB244.80 | In Stock |
|
| 25G | RMB416.00 | In Stock |
|
| 100G | RMB1952.00 | In Stock |
|
| 500g | RMB10399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 118-119 °C (lit.) |
| Density | 1.41 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | Liquid |
| color | Clear colorless |
| Specific Gravity | 1.41 |
| Sensitive | Air Sensitive |
| BRN | 7703632 |
| InChI | InChI=1S/C8H4F4O/c9-7-3-6(8(10,11)12)2-1-5(7)4-13/h1-4H |
| InChIKey | KFEHNXLFIGPWNB-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC=C(C(F)(F)F)C=C1F |
| CAS DataBase Reference | 89763-93-9(CAS DataBase Reference) |
Description and Uses
2-Fluoro-4-(trifluoromethyl)benzaldehyde may be used in the synthesis of methyl 3-amino-6-(trifluoromethyl)benzo[b]thiophene-2-carboxylate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29130000 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






