A4349712
2-Fluoro-6-iodotoluene , 97% , 443-85-6
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB23.20 | In Stock |
|
| 1G | RMB28.80 | In Stock |
|
| 5G | RMB92.00 | In Stock |
|
| 25G | RMB331.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 117 °C/9 mmHg (lit.) |
| Density | 1.8080 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 184 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| Sensitive | Light Sensitive |
| InChI | InChI=1S/C7H6FI/c1-5-6(8)3-2-4-7(5)9/h2-4H,1H3 |
| InChIKey | MSPXWJMFEVAKHQ-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=CC(I)=C1C |
| CAS DataBase Reference | 443-85-6(CAS DataBase Reference) |
Safety
| Symbol(GHS) |   GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H318 |
| Precautionary statements | P280-P301+P310+P330-P305+P351+P338+P310 |
| Hazard Codes | Xn,N,Xi |
| Risk Statements | 22-41-51/53 |
| Safety Statements | 26-39-61 |
| RIDADR | UN 2810 6.1/PG 3 |
| WGK Germany | 2 |
| HazardClass | IRRITANT |
| HS Code | 29039990 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
