A4372212
N-(9-Fmoc)-L-glutamic acid γ-tert-butyl ester monohydrate , 98% , 204251-24-1
Synonym(s):
N-(9-Fluorenylmethoxycarbonyl)-L -glutamic acid γ-tert-butyl ester monohydrate
| Pack Size | Price | Stock | Quantity |
| 1G | RMB28.80 | In Stock |
|
| 5G | RMB35.20 | In Stock |
|
| 25g | RMB135.36 | In Stock |
|
| 100g | RMB418.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 86-89 °C(lit.) |
| storage temp. | Sealed in dry,2-8°C |
| form | Powder |
| color | White to off-white |
| optical activity | [α]20/D 17.5°, c = 1 in DMF |
| InChIKey | NMBGBVUJSPZRDD-BDQAORGHSA-N |
| SMILES | C(C1C2=CC=CC=C2C2=CC=CC=C12)OC(=O)N[C@H](C(=O)O)CCC(=O)OC(C)(C)C.O |&1:18,r| |
Description and Uses
As a protective structural unit for introducing glutamate into peptides.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Safety Statements | 24/25-22 |
| WGK Germany | 3 |
| HS Code | 29242990 |
