PRODUCT Properties
| Melting point: | 246-250 °C (lit.) |
| Boiling point: | 254.32°C (rough estimate) |
| Density | 1.3579 (rough estimate) |
| refractive index | 1.5090 (estimate) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | 4.22±0.10(Predicted) |
| form | solid |
| Appearance | White to yellow Solid |
| InChI | InChI=1S/C8H6O4/c9-4-6-3-5(8(11)12)1-2-7(6)10/h1-4,10H,(H,11,12) |
| InChIKey | NXZBZWZORYEIJL-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(O)C(C=O)=C1 |
Description and Uses
3-FORMYL-4-HYDROXYBENZOIC ACID is used as an intermediate in the synthesis of MOF material ligands or COF material monomers.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H317-H319 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-36/38 |
| Safety Statements | 26-36/37 |
| WGK Germany | 2 |
| HS Code | 2918999090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |






