A4812512
4-Hydroxyisophthalic Acid , >98.0%(HPLC)(T) , 636-46-4
Synonym(s):
4-Hydroxy 1,3-benzenedicarboxylic acid
CAS NO.：636-46-4
Empirical Formula: C8H6O5
Molecular Weight: 182.13
MDL number: MFCD00010391
EINECS: 211-258-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB41.60 | In Stock |
|
| 5G | RMB133.60 | In Stock |
|
| 25G | RMB472.00 | In Stock |
|
| 100G | RMB1413.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300°C |
| Boiling point: | 310 C |
| Density | 1.4411 (rough estimate) |
| refractive index | 1.5690 (estimate) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | solid |
| pka | 2?+-.0.10(Predicted) |
| color | White to Pale Purple |
| Water Solubility | 0.3g/L(24 ºC) |
| Merck | 14,4827 |
| Stability: | Hygroscopic |
| InChI | 1S/C8H6O5/c9-6-2-1-4(7(10)11)3-5(6)8(12)13/h1-3,9H,(H,10,11)(H,12,13) |
| InChIKey | BCEQKAQCUWUNML-UHFFFAOYSA-N |
| SMILES | OC(C1=CC(C(O)=O)=C(O)C=C1)=O |
| CAS DataBase Reference | 636-46-4(CAS DataBase Reference) |
Description and Uses
4-Hydroxyisophthalic acid has been proposed as an improvement over aspirin. An impurity of Acetylsalicylic acid (A187780). Acetylsalicylic Acid Impurity B; Aspirin Impurity B
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-41-22-36/38 |
| Safety Statements | 26-36/37/39-36-39-6 |
| WGK Germany | 3 |
| RTECS | NT2544000 |
| HS Code | 29182900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
