A4376612
4-fluoro-3-phenoxybenzaldehyde , ≥97.0%(GC) , 68359-57-9
CAS NO.:68359-57-9
Empirical Formula: C13H9FO2
Molecular Weight: 216.21
MDL number: MFCD01318148
EINECS: 269-856-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB147.20 | In Stock |
|
| 25G | RMB585.60 | In Stock |
|
| 100g | RMB1839.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 310 |
| Density | 1.2091 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | Liquid |
| color | Colorless |
| InChI | InChI=1S/C13H9FO2/c14-12-7-6-10(9-15)8-13(12)16-11-4-2-1-3-5-11/h1-9H |
| InChIKey | JDICMOLUAHZVDS-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC=C(F)C(OC2=CC=CC=C2)=C1 |
| CAS DataBase Reference | 68359-57-9(CAS DataBase Reference) |
| EPA Substance Registry System | 4-Fluoro-3-phenoxybenzaldehyde (68359-57-9) |
Description and Uses
4-Fluoro-3-phenoxybenzaldehyde is a reactant in the preparation of ring-disubstituted propyl cyano(phenyl)propenoates which are then used as copolymers with styrene.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H401-H302-H411 |
| Precautionary statements | P273-P301+P312+P330-P391-P501-P264-P270-P301+P312a-P330-P501a |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn,N |
| Risk Statements | 22-51/53 |
| Safety Statements | 61 |
| RIDADR | UN 3082 9/PG 3 |
| WGK Germany | 2 |
| Hazard Note | Harmful |
| TSCA | TSCA listed |
| HazardClass | 9 |
| HS Code | 29130000 |
| Storage Class | 12 - Non Combustible Liquids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 2 |








