A4381512
4-Fluoro-3-(trifluoromethyl)benzoic Acid , ≥98.0%(GC) , 67515-55-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB47.20 | In Stock |
|
| 5G | RMB109.60 | In Stock |
|
| 25G | RMB369.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 114-116 °C (lit.) |
| Boiling point: | 256.9±40.0 °C(Predicted) |
| Density | 1.489±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 3.71±0.10(Predicted) |
| color | White to Almost white |
| BRN | 1968716 |
| InChI | InChI=1S/C8H4F4O2/c9-6-2-1-4(7(13)14)3-5(6)8(10,11)12/h1-3H,(H,13,14) |
| InChIKey | WZBPZYCJUADXRS-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(F)C(C(F)(F)F)=C1 |
| CAS DataBase Reference | 67515-55-3(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Fluoro-3-(trifluomethyl)benzoic acid(67515-55-3) |
Description and Uses
In the field of chemical synthesis, 4-fluoro-3-(trifluoromethyl)benzoic acid is often used as a synthetic intermediate for the preparation of organometallic complexes and active pharmaceutical ingredients (APIs).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






