A4385512
2-Fluoro-1-methylpyridinium p-toluenesulfonate , ≥98% , 58086-67-2
CAS NO.：58086-67-2
Empirical Formula: C13H14FNO3S
Molecular Weight: 283.32
MDL number: MFCD00011983
EINECS: 261-108-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB68.80 | In Stock |
|
| 5G | RMB243.20 | In Stock |
|
| 25G | RMB950.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 130-134 °C(lit.) |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | Acetonitrile (Sparingly), Methanol (Slightly) |
| form | Solid |
| color | White to Off-White |
| Water Solubility | Soluble in water (hydrolyzes), DMSO, dichloromethane, and acetonitrile. |
| Sensitive | Moisture Sensitive |
| BRN | 4345357 |
| Stability: | Moisture sensitive |
| InChI | InChI=1S/C7H8O3S.C6H7FN/c1-6-2-4-7(5-3-6)11(8,9)10;1-8-5-3-2-4-6(8)7/h2-5H,1H3,(H,8,9,10);2-5H,1H3/q;+1/p-1 |
| InChIKey | HQWDKLAIDBOLFE-UHFFFAOYSA-M |
| SMILES | C1(S(=O)([O-])=O)C=CC(C)=CC=1.C1(F)C=CC=C[N+]=1C |
| CAS DataBase Reference | 58086-67-2(CAS DataBase Reference) |
Description and Uses
2-Fluoro-1-methylpyridinium p-toluenesulfonate Is a peptide coupling reagent. Also used in the synthesis of ? -ribonucleotides.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-26 |
| WGK Germany | 3 |
| F | 3-10-21 |
| Hazard Note | Irritant |
| HS Code | 29333990 |
