A4385712
2-Fluoro-6-(trifluoromethyl)benzaldehyde , ≥98% , 60611-24-7
CAS NO.：60611-24-7
Empirical Formula: C8H4F4O
Molecular Weight: 192.11
MDL number: MFCD00061273
EINECS: 625-623-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB36.80 | In Stock |
|
| 5G | RMB150.40 | In Stock |
|
| 25G | RMB604.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 155-157°C |
| Boiling point: | 156 °C (lit.) |
| Density | 1.432 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 179 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Sensitive | Air Sensitive |
| BRN | 2263481 |
| InChI | InChI=1S/C8H4F4O/c9-7-3-1-2-6(5(7)4-13)8(10,11)12/h1-4H |
| InChIKey | FAKUGVHRTLCKHB-UHFFFAOYSA-N |
| SMILES | C(=O)C1=C(C(F)(F)F)C=CC=C1F |
| CAS DataBase Reference | 60611-24-7(CAS DataBase Reference) |
Description and Uses
2-Fluoro-6-(trifluoromethyl)benzaldehyde may be employed for the synthesis of diaryl ether, 2-(3,5-dimethoxyphenoxy)-6-(trifluoromethyl)- benzonitrile and substituted benzo[b]thiophene-2-carboxylates.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H227-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338-P210e-P280a-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29130000 |
