A4393312
2-Fluoro-5-(trifluoromethyl)benzoyl Chloride , >97% , 207981-46-2
CAS NO.：207981-46-2
Empirical Formula: C8H3ClF4O
Molecular Weight: 226.56
MDL number: MFCD00061156
EINECS: 632-656-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB72.80 | In Stock |
|
| 5G | RMB231.20 | In Stock |
|
| 25g | RMB951.20 | In Stock |
|
| 100g | RMB3683.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 191 °C (lit.) |
| Density | 1.499 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 200 °F |
| storage temp. | Refrigerator (+4°C) |
| form | clear liquid |
| color | Colorless to Light yellow |
| Specific Gravity | 1.499 |
| Sensitive | Moisture Sensitive |
| InChI | 1S/C8H3ClF4O/c9-7(14)5-3-4(8(11,12)13)1-2-6(5)10/h1-3H |
| InChIKey | OFVKAIZITGCCDN-UHFFFAOYSA-N |
| SMILES | Fc1ccc(cc1C(Cl)=O)C(F)(F)F |
| CAS DataBase Reference | 207981-46-2(CAS DataBase Reference) |
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H318-H314-H227-H290 |
| Precautionary statements | P309-P210-P234-P260-P264-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P370+P378-P390-P403+P235-P405-P406-P501-P280-P305+P351+P338-P310 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 23-26-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29163990 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
